C31H27F3O6 — CID 78139084
[2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl] 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 78139084) has the molecular formula C31H27F3O6 and a molecular weight of 552.55 g/mol. Its IUPAC name is [2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl] 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | [2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl] 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 78139084 |
| Molecular Formula | C31H27F3O6 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | [2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl] 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | COc1ccc(C=CC(=O)c2ccc(OC)c3c2OC(C)(C)C=C3)cc1OC(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H27F3O6/c1-30(2)15-14-23-25(37-3)13-10-22(29(23)40-30)24(35)11-8-19-9-12-26(38-4)27(17-19)39-28(36)18-20-6-5-7-21(16-20)31(32,33)34/h5-17H,18H2,1-4H3 |
| InChIKey | MZFXUKFIMRRQMH-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|