C30H26FNO3 — CID 90670532
(E)-3-[1-[(3-fluorophenyl)methyl]indol-6-yl]-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one (PubChem CID 90670532) has the molecular formula C30H26FNO3 and a molecular weight of 467.54 g/mol. Its IUPAC name is (E)-3-[1-[(3-fluorophenyl)methyl]indol-6-yl]-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[1-[(3-fluorophenyl)methyl]indol-6-yl]-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90670532 |
| Molecular Formula | C30H26FNO3 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (E)-3-[1-[(3-fluorophenyl)methyl]indol-6-yl]-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc3ccn(Cc4cccc(F)c4)c3c2)c2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C30H26FNO3/c1-30(2)15-13-25-28(34-3)12-10-24(29(25)35-30)27(33)11-8-20-7-9-22-14-16-32(26(22)18-20)19-21-5-4-6-23(31)17-21/h4-18H,19H2,1-3H3/b11-8+ |
| InChIKey | DQPIHRHMKGGAAE-DHZHZOJOSA-N |
| XLogP | 6.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|