C27H24O7 — CID 78139157
[2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl] furan-2-carboxylate (PubChem CID 78139157) has the molecular formula C27H24O7 and a molecular weight of 460.48 g/mol. Its IUPAC name is [2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 78139157 |
| Molecular Formula | C27H24O7 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl] furan-2-carboxylate |
| SMILES | COc1ccc(C=CC(=O)c2ccc(OC)c3c2OC(C)(C)C=C3)cc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C27H24O7/c1-27(2)14-13-19-21(30-3)12-9-18(25(19)34-27)20(28)10-7-17-8-11-22(31-4)24(16-17)33-26(29)23-6-5-15-32-23/h5-16H,1-4H3 |
| InChIKey | QWGHFAOWQVWUNA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|