C29H29NO6S — CID 123626686
N-[2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl]-1-phenylmethanesulfonamide (PubChem CID 123626686) has the molecular formula C29H29NO6S and a molecular weight of 519.62 g/mol. Its IUPAC name is N-[2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 123626686 |
| Molecular Formula | C29H29NO6S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | N-[2-methoxy-5-[3-(5-methoxy-2,2-dimethylchromen-8-yl)-3-oxoprop-1-enyl]phenyl]-1-phenylmethanesulfonamide |
| SMILES | COc1ccc(C=CC(=O)c2ccc(OC)c3c2OC(C)(C)C=C3)cc1NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H29NO6S/c1-29(2)17-16-23-26(34-3)15-12-22(28(23)36-29)25(31)13-10-20-11-14-27(35-4)24(18-20)30-37(32,33)19-21-8-6-5-7-9-21/h5-18,30H,19H2,1-4H3 |
| InChIKey | NIPIOEHNZJTZHT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|