C30H26BrNO3 — CID 90670519
(E)-3-[1-[(4-bromophenyl)methyl]indol-3-yl]-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one (PubChem CID 90670519) has the molecular formula C30H26BrNO3 and a molecular weight of 528.45 g/mol. Its IUPAC name is (E)-3-[1-[(4-bromophenyl)methyl]indol-3-yl]-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[1-[(4-bromophenyl)methyl]indol-3-yl]-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90670519 |
| Molecular Formula | C30H26BrNO3 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | (E)-3-[1-[(4-bromophenyl)methyl]indol-3-yl]-1-(5-methoxy-2,2-dimethylchromen-8-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cn(Cc3ccc(Br)cc3)c3ccccc23)c2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C30H26BrNO3/c1-30(2)17-16-25-28(34-3)15-13-24(29(25)35-30)27(33)14-10-21-19-32(26-7-5-4-6-23(21)26)18-20-8-11-22(31)12-9-20/h4-17,19H,18H2,1-3H3/b14-10+ |
| InChIKey | SJOCHNJXOAABQM-GXDHUFHOSA-N |
| XLogP | 7.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|