C22H23BrO8 — CID 46933331
(E)-3-(1,3-benzodioxol-5-yl)-1-[2-(2-bromoethoxy)-4,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one (PubChem CID 46933331) has the molecular formula C22H23BrO8 and a molecular weight of 495.32 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[2-(2-bromoethoxy)-4,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[2-(2-bromoethoxy)-4,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46933331 |
| Molecular Formula | C22H23BrO8 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[2-(2-bromoethoxy)-4,6-bis(methoxymethoxy)phenyl]prop-2-en-1-one |
| SMILES | COCOc1cc(OCCBr)c(C(=O)/C=C/c2ccc3c(c2)OCO3)c(OCOC)c1 |
| InChI | InChI=1S/C22H23BrO8/c1-25-12-28-16-10-20(27-8-7-23)22(21(11-16)29-13-26-2)17(24)5-3-15-4-6-18-19(9-15)31-14-30-18/h3-6,9-11H,7-8,12-14H2,1-2H3/b5-3+ |
| InChIKey | LBSBCTHEONETQB-HWKANZROSA-N |
| XLogP | 4.05 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|