C22H21N3O15 — CID 46933474
2-[2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3,5-bis(2-nitrooxyethoxy)phenoxy]ethyl nitrate (PubChem CID 46933474) has the molecular formula C22H21N3O15 and a molecular weight of 567.42 g/mol. Its IUPAC name is 2-[2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3,5-bis(2-nitrooxyethoxy)phenoxy]ethyl nitrate.
| Compound Name | 2-[2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3,5-bis(2-nitrooxyethoxy)phenoxy]ethyl nitrate |
|---|---|
| PubChem CID | 46933474 |
| Molecular Formula | C22H21N3O15 |
| Molecular Weight | 567.42 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | 2-[2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3,5-bis(2-nitrooxyethoxy)phenoxy]ethyl nitrate |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)c1c(OCCO[N+](=O)[O-])cc(OCCO[N+](=O)[O-])cc1OCCO[N+](=O)[O-] |
| InChI | InChI=1S/C22H21N3O15/c26-17(3-1-15-2-4-18-19(11-15)37-14-36-18)22-20(34-6-9-39-24(29)30)12-16(33-5-8-38-23(27)28)13-21(22)35-7-10-40-25(31)32/h1-4,11-13H,5-10,14H2/b3-1+ |
| InChIKey | XFVLYEDYIXUUMI-HNQUOIGGSA-N |
| XLogP | 2.07 |
| TPSA | 220.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|