C20H16O7 — CID 72625948
2-[3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]benzoic acid (PubChem CID 72625948) has the molecular formula C20H16O7 and a molecular weight of 368.34 g/mol. Its IUPAC name is 2-[3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 2-[3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 72625948 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[3-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-oxoprop-1-enyl]benzoic acid |
| SMILES | COc1c(C(=O)C=Cc2ccccc2C(=O)O)c(O)c(OC)c2occc12 |
| InChI | InChI=1S/C20H16O7/c1-25-17-13-9-10-27-18(13)19(26-2)16(22)15(17)14(21)8-7-11-5-3-4-6-12(11)20(23)24/h3-10,22H,1-2H3,(H,23,24) |
| InChIKey | DGDYTMRMADSRCW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|