C26H29NO11 — CID 6434292
2-[[5-[(E)-3-(2-hydroxy-3-methoxyphenyl)prop-2-enoyl]-4,7-dimethoxy-1-benzofuran-6-yl]oxy]ethyl-dimethylazanium;2-hydroxy-2-oxoacetate (PubChem CID 6434292) has the molecular formula C26H29NO11 and a molecular weight of 531.51 g/mol. Its IUPAC name is 2-[[5-[(E)-3-(2-hydroxy-3-methoxyphenyl)prop-2-enoyl]-4,7-dimethoxy-1-benzofuran-6-yl]oxy]ethyl-dimethylazanium;2-hydroxy-2-oxoacetate.
| Compound Name | 2-[[5-[(E)-3-(2-hydroxy-3-methoxyphenyl)prop-2-enoyl]-4,7-dimethoxy-1-benzofuran-6-yl]oxy]ethyl-dimethylazanium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 6434292 |
| Molecular Formula | C26H29NO11 |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 2-[[5-[(E)-3-(2-hydroxy-3-methoxyphenyl)prop-2-enoyl]-4,7-dimethoxy-1-benzofuran-6-yl]oxy]ethyl-dimethylazanium;2-hydroxy-2-oxoacetate |
| SMILES | COc1cccc(/C=C/C(=O)c2c(OCC[NH+](C)C)c(OC)c3occc3c2OC)c1O.O=C([O-])C(=O)O |
| InChI | InChI=1S/C24H27NO7.C2H2O4/c1-25(2)12-14-32-23-19(21(29-4)16-11-13-31-22(16)24(23)30-5)17(26)10-9-15-7-6-8-18(28-3)20(15)27;3-1(4)2(5)6/h6-11,13,27H,12,14H2,1-5H3;(H,3,4)(H,5,6)/b10-9+; |
| InChIKey | PAKKPDVNIBWDCL-RRABGKBLSA-N |
| XLogP | 0.40 |
| TPSA | 169.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|