C27H31NO10 — CID 20838258
(E)-1-[6-[2-(dimethylamino)propoxy]-4,7-dimethoxy-1-benzofuran-5-yl]-3-(4-methoxyphenyl)prop-2-en-1-one;oxalic acid (PubChem CID 20838258) has the molecular formula C27H31NO10 and a molecular weight of 529.54 g/mol. Its IUPAC name is (E)-1-[6-[2-(dimethylamino)propoxy]-4,7-dimethoxy-1-benzofuran-5-yl]-3-(4-methoxyphenyl)prop-2-en-1-one;oxalic acid.
| Compound Name | (E)-1-[6-[2-(dimethylamino)propoxy]-4,7-dimethoxy-1-benzofuran-5-yl]-3-(4-methoxyphenyl)prop-2-en-1-one;oxalic acid |
|---|---|
| PubChem CID | 20838258 |
| Molecular Formula | C27H31NO10 |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | (E)-1-[6-[2-(dimethylamino)propoxy]-4,7-dimethoxy-1-benzofuran-5-yl]-3-(4-methoxyphenyl)prop-2-en-1-one;oxalic acid |
| SMILES | COc1ccc(/C=C/C(=O)c2c(OCC(C)N(C)C)c(OC)c3occc3c2OC)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H29NO6.C2H2O4/c1-16(26(2)3)15-32-24-21(20(27)12-9-17-7-10-18(28-4)11-8-17)22(29-5)19-13-14-31-23(19)25(24)30-6;3-1(4)2(5)6/h7-14,16H,15H2,1-6H3;(H,3,4)(H,5,6)/b12-9+; |
| InChIKey | BJAPDHWDYPQEAD-NBYYMMLRSA-N |
| XLogP | 3.84 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|