C18H15NO5 — CID 14470492
(E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-pyridin-4-ylprop-2-en-1-one (PubChem CID 14470492) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-pyridin-4-ylprop-2-en-1-one.
| Compound Name | (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-pyridin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 14470492 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-pyridin-4-ylprop-2-en-1-one |
| SMILES | COc1c(C(=O)/C=C/c2ccncc2)c(O)c(OC)c2occc12 |
| InChI | InChI=1S/C18H15NO5/c1-22-16-12-7-10-24-17(12)18(23-2)15(21)14(16)13(20)4-3-11-5-8-19-9-6-11/h3-10,21H,1-2H3/b4-3+ |
| InChIKey | VZQOIBMZXJSHHM-ONEGZZNKSA-N |
| XLogP | 3.45 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|