C18H14O5 — CID 23251200
(E)-1-(4-hydroxy-6-methoxy-1-benzofuran-5-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 23251200) has the molecular formula C18H14O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is (E)-1-(4-hydroxy-6-methoxy-1-benzofuran-5-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-hydroxy-6-methoxy-1-benzofuran-5-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 23251200 |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (E)-1-(4-hydroxy-6-methoxy-1-benzofuran-5-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc2occc2c(O)c1C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C18H14O5/c1-22-16-10-15-13(8-9-23-15)18(21)17(16)14(20)7-4-11-2-5-12(19)6-3-11/h2-10,19,21H,1H3/b7-4+ |
| InChIKey | BRKRLCIDSNXAIB-QPJJXVBHSA-N |
| XLogP | 3.75 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|