C24H28O4 — CID 139632954
2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxoprop-1-enyl]benzoic acid (PubChem CID 139632954) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 139632954 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxoprop-1-enyl]benzoic acid |
| SMILES | CC(C)(C)c1cc(C(=O)C=Cc2ccccc2C(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H28O4/c1-23(2,3)18-13-16(14-19(21(18)26)24(4,5)6)20(25)12-11-15-9-7-8-10-17(15)22(27)28/h7-14,26H,1-6H3,(H,27,28) |
| InChIKey | UVUJVAGMPCCWRU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|