C30H34O3 — CID 132937099
methyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-diphenylprop-2-enoate (PubChem CID 132937099) has the molecular formula C30H34O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is methyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-diphenylprop-2-enoate.
| Compound Name | methyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 132937099 |
| Molecular Formula | C30H34O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | methyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-diphenylprop-2-enoate |
| SMILES | COC(=O)C(=C(c1ccccc1)c1ccccc1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H34O3/c1-29(2,3)23-18-22(19-24(27(23)31)30(4,5)6)26(28(32)33-7)25(20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-19,31H,1-7H3 |
| InChIKey | AZWFDBHJFDCBCE-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|