C34H38N2O6 — CID 158026912
N-(3,5-ditert-butyl-2,6-dihydroxyphenyl)benzamide;N-(2,6-dihydroxyphenyl)benzamide (PubChem CID 158026912) has the molecular formula C34H38N2O6 and a molecular weight of 570.69 g/mol. Its IUPAC name is N-(3,5-ditert-butyl-2,6-dihydroxyphenyl)benzamide;N-(2,6-dihydroxyphenyl)benzamide.
| Compound Name | N-(3,5-ditert-butyl-2,6-dihydroxyphenyl)benzamide;N-(2,6-dihydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 158026912 |
| Molecular Formula | C34H38N2O6 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | N-(3,5-ditert-butyl-2,6-dihydroxyphenyl)benzamide;N-(2,6-dihydroxyphenyl)benzamide |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(O)c(NC(=O)c2ccccc2)c1O.O=C(Nc1c(O)cccc1O)c1ccccc1 |
| InChI | InChI=1S/C21H27NO3.C13H11NO3/c1-20(2,3)14-12-15(21(4,5)6)18(24)16(17(14)23)22-19(25)13-10-8-7-9-11-13;15-10-7-4-8-11(16)12(10)14-13(17)9-5-2-1-3-6-9/h7-12,23-24H,1-6H3,(H,22,25);1-8,15-16H,(H,14,17) |
| InChIKey | FGSCTFYXYQTONZ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|