C24H29NO4 — CID 5369834
(Z)-2-benzamido-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid (PubChem CID 5369834) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (Z)-2-benzamido-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-benzamido-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 5369834 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (Z)-2-benzamido-3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enoic acid |
| SMILES | CC(C)(C)c1cc(/C=C(\NC(=O)c2ccccc2)C(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H29NO4/c1-23(2,3)17-12-15(13-18(20(17)26)24(4,5)6)14-19(22(28)29)25-21(27)16-10-8-7-9-11-16/h7-14,26H,1-6H3,(H,25,27)(H,28,29)/b19-14- |
| InChIKey | VFFLISJRDLFPJE-RGEXLXHISA-N |
| XLogP | 4.84 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|