C20H20ClNO5 — CID 4768678
2-benzamido-3-(3-chloro-4,5-diethoxyphenyl)prop-2-enoic acid (PubChem CID 4768678) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-benzamido-3-(3-chloro-4,5-diethoxyphenyl)prop-2-enoic acid.
| Compound Name | 2-benzamido-3-(3-chloro-4,5-diethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 4768678 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-benzamido-3-(3-chloro-4,5-diethoxyphenyl)prop-2-enoic acid |
| SMILES | CCOc1cc(C=C(NC(=O)c2ccccc2)C(=O)O)cc(Cl)c1OCC |
| InChI | InChI=1S/C20H20ClNO5/c1-3-26-17-12-13(10-15(21)18(17)27-4-2)11-16(20(24)25)22-19(23)14-8-6-5-7-9-14/h5-12H,3-4H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | MOJIBLUATKVYNX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|