C17H14ClNO5 — CID 6209896
(E)-2-benzamido-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid (PubChem CID 6209896) has the molecular formula C17H14ClNO5 and a molecular weight of 347.75 g/mol. Its IUPAC name is (E)-2-benzamido-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 6209896 |
| Molecular Formula | C17H14ClNO5 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (E)-2-benzamido-3-(3-chloro-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(/C=C(/NC(=O)c2ccccc2)C(=O)O)cc(Cl)c1O |
| InChI | InChI=1S/C17H14ClNO5/c1-24-14-9-10(7-12(18)15(14)20)8-13(17(22)23)19-16(21)11-5-3-2-4-6-11/h2-9,20H,1H3,(H,19,21)(H,22,23)/b13-8+ |
| InChIKey | ICPCYHBGSRAFRM-MDWZMJQESA-N |
| XLogP | 2.91 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|