C23H18ClNO5 — CID 22148439
(E)-2-benzamido-3-[4-(2-chloro-5-methoxyphenoxy)phenyl]prop-2-enoic acid (PubChem CID 22148439) has the molecular formula C23H18ClNO5 and a molecular weight of 423.85 g/mol. Its IUPAC name is (E)-2-benzamido-3-[4-(2-chloro-5-methoxyphenoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-[4-(2-chloro-5-methoxyphenoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22148439 |
| Molecular Formula | C23H18ClNO5 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | (E)-2-benzamido-3-[4-(2-chloro-5-methoxyphenoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(Cl)c(Oc2ccc(/C=C(/NC(=O)c3ccccc3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H18ClNO5/c1-29-18-11-12-19(24)21(14-18)30-17-9-7-15(8-10-17)13-20(23(27)28)25-22(26)16-5-3-2-4-6-16/h2-14H,1H3,(H,25,26)(H,27,28)/b20-13+ |
| InChIKey | HKCXHNXXAGEHCA-DEDYPNTBSA-N |
| XLogP | 5.00 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|