C22H15F2NO4 — CID 22148069
(E)-2-benzamido-3-[4-(2,5-difluorophenoxy)phenyl]prop-2-enoic acid (PubChem CID 22148069) has the molecular formula C22H15F2NO4 and a molecular weight of 395.36 g/mol. Its IUPAC name is (E)-2-benzamido-3-[4-(2,5-difluorophenoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-[4-(2,5-difluorophenoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22148069 |
| Molecular Formula | C22H15F2NO4 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (E)-2-benzamido-3-[4-(2,5-difluorophenoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc(Oc2cc(F)ccc2F)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H15F2NO4/c23-16-8-11-18(24)20(13-16)29-17-9-6-14(7-10-17)12-19(22(27)28)25-21(26)15-4-2-1-3-5-15/h1-13H,(H,25,26)(H,27,28)/b19-12+ |
| InChIKey | DFNQXVLSMIZJGN-XDHOZWIPSA-N |
| XLogP | 4.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|