C19H19NO5 — CID 45049758
(E)-2-benzamido-3-(2,4-dimethoxy-6-methylphenyl)prop-2-enoic acid (PubChem CID 45049758) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is (E)-2-benzamido-3-(2,4-dimethoxy-6-methylphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-benzamido-3-(2,4-dimethoxy-6-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 45049758 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (E)-2-benzamido-3-(2,4-dimethoxy-6-methylphenyl)prop-2-enoic acid |
| SMILES | COc1cc(C)c(/C=C(/NC(=O)c2ccccc2)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C19H19NO5/c1-12-9-14(24-2)10-17(25-3)15(12)11-16(19(22)23)20-18(21)13-7-5-4-6-8-13/h4-11H,1-3H3,(H,20,21)(H,22,23)/b16-11+ |
| InChIKey | RIQYZGLBZDWGJX-LFIBNONCSA-N |
| XLogP | 2.87 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|