C24H20ClNO5 — CID 4772635
2-benzamido-3-(3-chloro-5-methoxy-4-phenylmethoxyphenyl)prop-2-enoic acid (PubChem CID 4772635) has the molecular formula C24H20ClNO5 and a molecular weight of 437.88 g/mol. Its IUPAC name is 2-benzamido-3-(3-chloro-5-methoxy-4-phenylmethoxyphenyl)prop-2-enoic acid.
| Compound Name | 2-benzamido-3-(3-chloro-5-methoxy-4-phenylmethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 4772635 |
| Molecular Formula | C24H20ClNO5 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 2-benzamido-3-(3-chloro-5-methoxy-4-phenylmethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(C=C(NC(=O)c2ccccc2)C(=O)O)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H20ClNO5/c1-30-21-14-17(12-19(25)22(21)31-15-16-8-4-2-5-9-16)13-20(24(28)29)26-23(27)18-10-6-3-7-11-18/h2-14H,15H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | OFRBVGZRLNDERH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|