C24H20FNO5 — CID 4768835
2-benzamido-3-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoic acid (PubChem CID 4768835) has the molecular formula C24H20FNO5 and a molecular weight of 421.42 g/mol. Its IUPAC name is 2-benzamido-3-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoic acid.
| Compound Name | 2-benzamido-3-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 4768835 |
| Molecular Formula | C24H20FNO5 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-benzamido-3-[4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=C(NC(=O)c2ccccc2)C(=O)O)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C24H20FNO5/c1-30-22-14-16(10-11-21(22)31-15-17-6-5-9-19(25)12-17)13-20(24(28)29)26-23(27)18-7-3-2-4-8-18/h2-14H,15H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | GAPXFUGWCXRVPM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|