C16H15FN2O3S — CID 132591188
N-carbamothioyl-4-[(3-fluorophenyl)methoxy]-3-methoxybenzamide (PubChem CID 132591188) has the molecular formula C16H15FN2O3S and a molecular weight of 334.37 g/mol. Its IUPAC name is N-carbamothioyl-4-[(3-fluorophenyl)methoxy]-3-methoxybenzamide.
| Compound Name | N-carbamothioyl-4-[(3-fluorophenyl)methoxy]-3-methoxybenzamide |
|---|---|
| PubChem CID | 132591188 |
| Molecular Formula | C16H15FN2O3S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-carbamothioyl-4-[(3-fluorophenyl)methoxy]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC(N)=S)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C16H15FN2O3S/c1-21-14-8-11(15(20)19-16(18)23)5-6-13(14)22-9-10-3-2-4-12(17)7-10/h2-8H,9H2,1H3,(H3,18,19,20,23) |
| InChIKey | APDUTKYSTXURJR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|