C20H20ClNO5 — CID 6209537
(E)-2-acetamido-3-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)prop-2-enoic acid (PubChem CID 6209537) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is (E)-2-acetamido-3-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 6209537 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (E)-2-acetamido-3-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)prop-2-enoic acid |
| SMILES | CCOc1cc(/C=C(/NC(C)=O)C(=O)O)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C20H20ClNO5/c1-3-26-18-11-15(10-17(20(24)25)22-13(2)23)9-16(21)19(18)27-12-14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3,(H,22,23)(H,24,25)/b17-10+ |
| InChIKey | TXFFCVDRTURTKT-LICLKQGHSA-N |
| XLogP | 3.88 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|