C21H22INO5 — CID 6209840
(E)-2-acetamido-3-[3-ethoxy-5-iodo-4-(2-phenylethoxy)phenyl]prop-2-enoic acid (PubChem CID 6209840) has the molecular formula C21H22INO5 and a molecular weight of 495.31 g/mol. Its IUPAC name is (E)-2-acetamido-3-[3-ethoxy-5-iodo-4-(2-phenylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-[3-ethoxy-5-iodo-4-(2-phenylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6209840 |
| Molecular Formula | C21H22INO5 |
| Molecular Weight | 495.31 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | (E)-2-acetamido-3-[3-ethoxy-5-iodo-4-(2-phenylethoxy)phenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(/C=C(/NC(C)=O)C(=O)O)cc(I)c1OCCc1ccccc1 |
| InChI | InChI=1S/C21H22INO5/c1-3-27-19-13-16(12-18(21(25)26)23-14(2)24)11-17(22)20(19)28-10-9-15-7-5-4-6-8-15/h4-8,11-13H,3,9-10H2,1-2H3,(H,23,24)(H,25,26)/b18-12+ |
| InChIKey | FAEOWRIUFGWFIO-LDADJPATSA-N |
| XLogP | 3.87 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|