C20H19ClINO5 — CID 4768224
2-acetamido-3-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]prop-2-enoic acid (PubChem CID 4768224) has the molecular formula C20H19ClINO5 and a molecular weight of 515.73 g/mol. Its IUPAC name is 2-acetamido-3-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]prop-2-enoic acid.
| Compound Name | 2-acetamido-3-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 4768224 |
| Molecular Formula | C20H19ClINO5 |
| Molecular Weight | 515.73 g/mol |
| Exact Mass | 515.00 |
| IUPAC Name | 2-acetamido-3-[4-[(3-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(C=C(NC(C)=O)C(=O)O)cc(I)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19ClINO5/c1-3-27-18-10-14(9-17(20(25)26)23-12(2)24)8-16(22)19(18)28-11-13-5-4-6-15(21)7-13/h4-10H,3,11H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | NPLCOLQEPGQOSM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|