C15H18BrNO5 — CID 6209528
(E)-2-acetamido-3-(3-bromo-4,5-diethoxyphenyl)prop-2-enoic acid (PubChem CID 6209528) has the molecular formula C15H18BrNO5 and a molecular weight of 372.22 g/mol. Its IUPAC name is (E)-2-acetamido-3-(3-bromo-4,5-diethoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-(3-bromo-4,5-diethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 6209528 |
| Molecular Formula | C15H18BrNO5 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | (E)-2-acetamido-3-(3-bromo-4,5-diethoxyphenyl)prop-2-enoic acid |
| SMILES | CCOc1cc(/C=C(/NC(C)=O)C(=O)O)cc(Br)c1OCC |
| InChI | InChI=1S/C15H18BrNO5/c1-4-21-13-8-10(6-11(16)14(13)22-5-2)7-12(15(19)20)17-9(3)18/h6-8H,4-5H2,1-3H3,(H,17,18)(H,19,20)/b12-7+ |
| InChIKey | IVOCLEYDOREJOJ-KPKJPENVSA-N |
| XLogP | 2.81 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|