C15H15Br2NO4 — CID 6209763
(E)-2-acetamido-3-[3,5-dibromo-4-(2-methylprop-2-enoxy)phenyl]prop-2-enoic acid (PubChem CID 6209763) has the molecular formula C15H15Br2NO4 and a molecular weight of 433.10 g/mol. Its IUPAC name is (E)-2-acetamido-3-[3,5-dibromo-4-(2-methylprop-2-enoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-[3,5-dibromo-4-(2-methylprop-2-enoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6209763 |
| Molecular Formula | C15H15Br2NO4 |
| Molecular Weight | 433.10 g/mol |
| Exact Mass | 430.94 |
| IUPAC Name | (E)-2-acetamido-3-[3,5-dibromo-4-(2-methylprop-2-enoxy)phenyl]prop-2-enoic acid |
| SMILES | C=C(C)COc1c(Br)cc(/C=C(/NC(C)=O)C(=O)O)cc1Br |
| InChI | InChI=1S/C15H15Br2NO4/c1-8(2)7-22-14-11(16)4-10(5-12(14)17)6-13(15(20)21)18-9(3)19/h4-6H,1,7H2,2-3H3,(H,18,19)(H,20,21)/b13-6+ |
| InChIKey | OTENZJODTQFEGM-AWNIVKPZSA-N |
| XLogP | 3.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.10 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|