C19H17ClINO5 — CID 6210619
(E)-2-acetamido-3-[3-chloro-4-[(2-iodophenyl)methoxy]-5-methoxyphenyl]prop-2-enoic acid (PubChem CID 6210619) has the molecular formula C19H17ClINO5 and a molecular weight of 501.70 g/mol. Its IUPAC name is (E)-2-acetamido-3-[3-chloro-4-[(2-iodophenyl)methoxy]-5-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-2-acetamido-3-[3-chloro-4-[(2-iodophenyl)methoxy]-5-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6210619 |
| Molecular Formula | C19H17ClINO5 |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | (E)-2-acetamido-3-[3-chloro-4-[(2-iodophenyl)methoxy]-5-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C(/NC(C)=O)C(=O)O)cc(Cl)c1OCc1ccccc1I |
| InChI | InChI=1S/C19H17ClINO5/c1-11(23)22-16(19(24)25)8-12-7-14(20)18(17(9-12)26-2)27-10-13-5-3-4-6-15(13)21/h3-9H,10H2,1-2H3,(H,22,23)(H,24,25)/b16-8+ |
| InChIKey | FRDDWJHLIOFFQN-LZYBPNLTSA-N |
| XLogP | 4.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|