C18H17ClO4 — CID 22681917
(Z)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-phenylprop-2-enoic acid (PubChem CID 22681917) has the molecular formula C18H17ClO4 and a molecular weight of 332.78 g/mol. Its IUPAC name is (Z)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-phenylprop-2-enoic acid.
| Compound Name | (Z)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 22681917 |
| Molecular Formula | C18H17ClO4 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (Z)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-2-phenylprop-2-enoic acid |
| SMILES | CCOc1c(Cl)cc(/C=C(\C(=O)O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H17ClO4/c1-3-23-17-15(19)10-12(11-16(17)22-2)9-14(18(20)21)13-7-5-4-6-8-13/h4-11H,3H2,1-2H3,(H,20,21)/b14-9- |
| InChIKey | STGNURWIYGNMCL-ZROIWOOFSA-N |
| XLogP | 4.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|