C15H13ClO4S — CID 20994247
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-thiophen-2-ylprop-2-enoic acid (PubChem CID 20994247) has the molecular formula C15H13ClO4S and a molecular weight of 324.79 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-thiophen-2-ylprop-2-enoic acid.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-thiophen-2-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 20994247 |
| Molecular Formula | C15H13ClO4S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-thiophen-2-ylprop-2-enoic acid |
| SMILES | COc1cc(/C=C(\C(=O)O)c2cccs2)cc(Cl)c1OC |
| InChI | InChI=1S/C15H13ClO4S/c1-19-12-8-9(7-11(16)14(12)20-2)6-10(15(17)18)13-4-3-5-21-13/h3-8H,1-2H3,(H,17,18)/b10-6- |
| InChIKey | ZRZTUENDKBDZLG-POHAHGRESA-N |
| XLogP | 4.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|