C12H13ClO4 — CID 170873206
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid (PubChem CID 170873206) has the molecular formula C12H13ClO4 and a molecular weight of 256.68 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 170873206 |
| Molecular Formula | C12H13ClO4 |
| Molecular Weight | 256.68 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid |
| SMILES | COc1cc(/C=C(\C)C(=O)O)cc(Cl)c1OC |
| InChI | InChI=1S/C12H13ClO4/c1-7(12(14)15)4-8-5-9(13)11(17-3)10(6-8)16-2/h4-6H,1-3H3,(H,14,15)/b7-4+ |
| InChIKey | JQQAYSOMTRGOIR-QPJJXVBHSA-N |
| XLogP | 2.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.68 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|