C12H14O5 — CID 170873128
(E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid (PubChem CID 170873128) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 170873128 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid |
| SMILES | COc1cc(/C=C(\C)C(=O)O)cc(O)c1OC |
| InChI | InChI=1S/C12H14O5/c1-7(12(14)15)4-8-5-9(13)11(17-3)10(6-8)16-2/h4-6,13H,1-3H3,(H,14,15)/b7-4+ |
| InChIKey | QBIVIMKBOYRYJV-QPJJXVBHSA-N |
| XLogP | 1.90 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|