(E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid

C12H14O5 — CID 170873128

IUPAC(E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid
SMILESCOc1cc(/C=C(\C)C(=O)O)cc(O)c1OC
InChIInChI=1S/C12H14O5/c1-7(12(14)15)4-8-5-9(13)11(17-3)10(6-8)16-2/h4-6,13H,1-3H3,(H,14,15)/b7-4+
InChIKeyQBIVIMKBOYRYJV-QPJJXVBHSA-N
MW238.24 g/mol
LogP1.90
Rot. Bonds4

About (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid

(E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid (PubChem CID 170873128) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid
PubChem CID170873128
Molecular FormulaC12H14O5
Molecular Weight238.24 g/mol
Exact Mass238.08
IUPAC Name(E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid
SMILESCOc1cc(/C=C(\C)C(=O)O)cc(O)c1OC
InChIInChI=1S/C12H14O5/c1-7(12(14)15)4-8-5-9(13)11(17-3)10(6-8)16-2/h4-6,13H,1-3H3,(H,14,15)/b7-4+
InChIKeyQBIVIMKBOYRYJV-QPJJXVBHSA-N
XLogP1.90
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 51.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid?
The IUPAC name of (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid (CID 170873128) is (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid.
What is the SMILES notation for (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid?
The canonical SMILES for (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid is COc1cc(/C=C(\C)C(=O)O)cc(O)c1OC.
What is the InChIKey of (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid?
The InChIKey is QBIVIMKBOYRYJV-QPJJXVBHSA-N. The full InChI is InChI=1S/C12H14O5/c1-7(12(14)15)4-8-5-9(13)11(17-3)10(6-8)16-2/h4-6,13H,1-3H3,(H,14,15)/b7-4+.
What are the key properties of (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid?
(E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid has a molecular weight of 238.24 g/mol, XLogP of 1.90, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3-hydroxy-4,5-dimethoxyphenyl)-2-methylprop-2-enoic acid is sourced from PubChem (CID 170873128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).