C12H12F2O4 — CID 79727135
3-[3-(difluoromethoxy)-4-methoxyphenyl]-2-methylprop-2-enoic acid (PubChem CID 79727135) has the molecular formula C12H12F2O4 and a molecular weight of 258.22 g/mol. Its IUPAC name is 3-[3-(difluoromethoxy)-4-methoxyphenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[3-(difluoromethoxy)-4-methoxyphenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 79727135 |
| Molecular Formula | C12H12F2O4 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-[3-(difluoromethoxy)-4-methoxyphenyl]-2-methylprop-2-enoic acid |
| SMILES | COc1ccc(C=C(C)C(=O)O)cc1OC(F)F |
| InChI | InChI=1S/C12H12F2O4/c1-7(11(15)16)5-8-3-4-9(17-2)10(6-8)18-12(13)14/h3-6,12H,1-2H3,(H,15,16) |
| InChIKey | PKBMLIZXQHLRKT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|