C19H17F2O6- — CID 2344559
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 2344559) has the molecular formula C19H17F2O6- and a molecular weight of 379.34 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2344559 |
| Molecular Formula | C19H17F2O6- |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-2-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C(=C\c2ccc(OC(F)F)c(OC)c2)C(=O)[O-])cc1OC |
| InChI | InChI=1S/C19H18F2O6/c1-24-14-7-5-12(10-17(14)26-3)13(18(22)23)8-11-4-6-15(27-19(20)21)16(9-11)25-2/h4-10,19H,1-3H3,(H,22,23)/p-1/b13-8+ |
| InChIKey | QQYYMQQANNDTRE-MDWZMJQESA-M |
| XLogP | 2.60 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|