C23H28O6 — CID 5468999
2-methylpropyl (Z)-2,3-bis(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 5468999) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 2-methylpropyl (Z)-2,3-bis(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | 2-methylpropyl (Z)-2,3-bis(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5468999 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-methylpropyl (Z)-2,3-bis(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C(\C(=O)OCC(C)C)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C23H28O6/c1-15(2)14-29-23(24)18(17-8-10-20(26-4)22(13-17)28-6)11-16-7-9-19(25-3)21(12-16)27-5/h7-13,15H,14H2,1-6H3/b18-11- |
| InChIKey | KMAUYUJXBGTMIJ-WQRHYEAKSA-N |
| XLogP | 4.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|