C20H21FO4 — CID 83952582
(Z)-2-(4-fluorophenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoic acid (PubChem CID 83952582) has the molecular formula C20H21FO4 and a molecular weight of 344.38 g/mol. Its IUPAC name is (Z)-2-(4-fluorophenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-(4-fluorophenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 83952582 |
| Molecular Formula | C20H21FO4 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (Z)-2-(4-fluorophenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C(\C(=O)O)c2ccc(F)cc2)ccc1OCC(C)C |
| InChI | InChI=1S/C20H21FO4/c1-13(2)12-25-18-9-4-14(11-19(18)24-3)10-17(20(22)23)15-5-7-16(21)8-6-15/h4-11,13H,12H2,1-3H3,(H,22,23)/b17-10- |
| InChIKey | JDBNGARZYCXVJS-YVLHZVERSA-N |
| XLogP | 4.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|