C19H20O5 — CID 83953947
(Z)-2-(4-hydroxyphenyl)-3-(4-methoxy-3-propoxyphenyl)prop-2-enoic acid (PubChem CID 83953947) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is (Z)-2-(4-hydroxyphenyl)-3-(4-methoxy-3-propoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(4-hydroxyphenyl)-3-(4-methoxy-3-propoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83953947 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (Z)-2-(4-hydroxyphenyl)-3-(4-methoxy-3-propoxyphenyl)prop-2-enoic acid |
| SMILES | CCCOc1cc(/C=C(\C(=O)O)c2ccc(O)cc2)ccc1OC |
| InChI | InChI=1S/C19H20O5/c1-3-10-24-18-12-13(4-9-17(18)23-2)11-16(19(21)22)14-5-7-15(20)8-6-14/h4-9,11-12,20H,3,10H2,1-2H3,(H,21,22)/b16-11- |
| InChIKey | UYOHJOMQIVBLEU-WJDWOHSUSA-N |
| XLogP | 3.81 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|