C13H17F2NO2 — CID 79322998
2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylidene]butan-1-amine (PubChem CID 79322998) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylidene]butan-1-amine.
| Compound Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylidene]butan-1-amine |
|---|---|
| PubChem CID | 79322998 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylidene]butan-1-amine |
| SMILES | CCC(=Cc1ccc(OC)c(OC(F)F)c1)CN |
| InChI | InChI=1S/C13H17F2NO2/c1-3-9(8-16)6-10-4-5-11(17-2)12(7-10)18-13(14)15/h4-7,13H,3,8,16H2,1-2H3 |
| InChIKey | DSUJBHFIHWEXNG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |