C12H15F2NO2 — CID 63970735
(E)-4-[3-(difluoromethoxy)-4-methoxyphenyl]but-3-en-1-amine (PubChem CID 63970735) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is (E)-4-[3-(difluoromethoxy)-4-methoxyphenyl]but-3-en-1-amine.
| Compound Name | (E)-4-[3-(difluoromethoxy)-4-methoxyphenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 63970735 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (E)-4-[3-(difluoromethoxy)-4-methoxyphenyl]but-3-en-1-amine |
| SMILES | COc1ccc(/C=C/CCN)cc1OC(F)F |
| InChI | InChI=1S/C12H15F2NO2/c1-16-10-6-5-9(4-2-3-7-15)8-11(10)17-12(13)14/h2,4-6,8,12H,3,7,15H2,1H3/b4-2+ |
| InChIKey | DOYXVZQSDABGAJ-DUXPYHPUSA-N |
| XLogP | 2.66 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |