C13H18O2 — CID 12892889
1,2-dimethoxy-4-[(E)-pent-1-enyl]benzene (PubChem CID 12892889) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1,2-dimethoxy-4-[(E)-pent-1-enyl]benzene.
| Compound Name | 1,2-dimethoxy-4-[(E)-pent-1-enyl]benzene |
|---|---|
| PubChem CID | 12892889 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1,2-dimethoxy-4-[(E)-pent-1-enyl]benzene |
| SMILES | CCC/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H18O2/c1-4-5-6-7-11-8-9-12(14-2)13(10-11)15-3/h6-10H,4-5H2,1-3H3/b7-6+ |
| InChIKey | CHXGKXZGBGTGDR-VOTSOKGWSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |