C12H16O6S — CID 162818086
4-(3,4-dimethoxyphenyl)but-3-enyl hydrogen sulfate (PubChem CID 162818086) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)but-3-enyl hydrogen sulfate.
| Compound Name | 4-(3,4-dimethoxyphenyl)but-3-enyl hydrogen sulfate |
|---|---|
| PubChem CID | 162818086 |
| Molecular Formula | C12H16O6S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)but-3-enyl hydrogen sulfate |
| SMILES | COc1ccc(C=CCCOS(=O)(=O)O)cc1OC |
| InChI | InChI=1S/C12H16O6S/c1-16-11-7-6-10(9-12(11)17-2)5-3-4-8-18-19(13,14)15/h3,5-7,9H,4,8H2,1-2H3,(H,13,14,15) |
| InChIKey | DQZVPOFDTCTUJF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|