S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate

C14H18O3S — CID 170480387

IUPACS-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate
SMILESCOc1ccc(C=CCCSC(C)=O)cc1OC
InChIInChI=1S/C14H18O3S/c1-11(15)18-9-5-4-6-12-7-8-13(16-2)14(10-12)17-3/h4,6-8,10H,5,9H2,1-3H3
InChIKeyMWRDEXVECRLVFO-UHFFFAOYSA-N
MW266.36 g/mol
LogP3.39
Rot. Bonds6

About S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate

S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate (PubChem CID 170480387) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate.

Molecular Properties

Compound NameS-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate
PubChem CID170480387
Molecular FormulaC14H18O3S
Molecular Weight266.36 g/mol
Exact Mass266.10
IUPAC NameS-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate
SMILESCOc1ccc(C=CCCSC(C)=O)cc1OC
InChIInChI=1S/C14H18O3S/c1-11(15)18-9-5-4-6-12-7-8-13(16-2)14(10-12)17-3/h4,6-8,10H,5,9H2,1-3H3
InChIKeyMWRDEXVECRLVFO-UHFFFAOYSA-N
XLogP3.39
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.36
LogP ≤ 53.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate?
The IUPAC name of S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate (CID 170480387) is S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate.
What is the SMILES notation for S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate?
The canonical SMILES for S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate is COc1ccc(C=CCCSC(C)=O)cc1OC.
What is the InChIKey of S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate?
The InChIKey is MWRDEXVECRLVFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3S/c1-11(15)18-9-5-4-6-12-7-8-13(16-2)14(10-12)17-3/h4,6-8,10H,5,9H2,1-3H3.
What are the key properties of S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate?
S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate has a molecular weight of 266.36 g/mol, XLogP of 3.39, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[4-(3,4-dimethoxyphenyl)but-3-enyl] ethanethioate is sourced from PubChem (CID 170480387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).