C13H14F3NO2S — CID 170481019
S-[4-[4-amino-3-(trifluoromethoxy)phenyl]but-3-enyl] ethanethioate (PubChem CID 170481019) has the molecular formula C13H14F3NO2S and a molecular weight of 305.32 g/mol. Its IUPAC name is S-[4-[4-amino-3-(trifluoromethoxy)phenyl]but-3-enyl] ethanethioate.
| Compound Name | S-[4-[4-amino-3-(trifluoromethoxy)phenyl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170481019 |
| Molecular Formula | C13H14F3NO2S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | S-[4-[4-amino-3-(trifluoromethoxy)phenyl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1ccc(N)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F3NO2S/c1-9(18)20-7-3-2-4-10-5-6-11(17)12(8-10)19-13(14,15)16/h2,4-6,8H,3,7,17H2,1H3 |
| InChIKey | XOQLSXIESUMQMC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|