C13H17NO2S — CID 170480198
S-[4-[4-amino-3-(hydroxymethyl)phenyl]but-3-enyl] ethanethioate (PubChem CID 170480198) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is S-[4-[4-amino-3-(hydroxymethyl)phenyl]but-3-enyl] ethanethioate.
| Compound Name | S-[4-[4-amino-3-(hydroxymethyl)phenyl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480198 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | S-[4-[4-amino-3-(hydroxymethyl)phenyl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1ccc(N)c(CO)c1 |
| InChI | InChI=1S/C13H17NO2S/c1-10(16)17-7-3-2-4-11-5-6-13(14)12(8-11)9-15/h2,4-6,8,15H,3,7,9,14H2,1H3 |
| InChIKey | JCXYXSDQKIUYFH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|