C14H19NOS — CID 170480139
S-[4-(4-amino-3,5-dimethylphenyl)but-3-enyl] ethanethioate (PubChem CID 170480139) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is S-[4-(4-amino-3,5-dimethylphenyl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(4-amino-3,5-dimethylphenyl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480139 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | S-[4-(4-amino-3,5-dimethylphenyl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/C14H19NOS/c1-10-8-13(9-11(2)14(10)15)6-4-5-7-17-12(3)16/h4,6,8-9H,5,7,15H2,1-3H3 |
| InChIKey | FKUCRAPALPSBEU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|