About 4-(4-aminobut-1-enyl)-2,6-dimethylaniline
4-(4-aminobut-1-enyl)-2,6-dimethylaniline (PubChem CID 170486974) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-(4-aminobut-1-enyl)-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-(4-aminobut-1-enyl)-2,6-dimethylaniline |
| PubChem CID | 170486974 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-(4-aminobut-1-enyl)-2,6-dimethylaniline |
| SMILES | Cc1cc(C=CCCN)cc(C)c1N |
| InChI | InChI=1S/C12H18N2/c1-9-7-11(5-3-4-6-13)8-10(2)12(9)14/h3,5,7-8H,4,6,13-14H2,1-2H3 |
| InChIKey | JQGHFKGWKKYHMJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminobut-1-enyl)-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminobut-1-enyl)-2,6-dimethylaniline?
The IUPAC name of 4-(4-aminobut-1-enyl)-2,6-dimethylaniline (CID 170486974) is 4-(4-aminobut-1-enyl)-2,6-dimethylaniline.
What is the SMILES notation for 4-(4-aminobut-1-enyl)-2,6-dimethylaniline?
The canonical SMILES for 4-(4-aminobut-1-enyl)-2,6-dimethylaniline is Cc1cc(C=CCCN)cc(C)c1N.
What is the InChIKey of 4-(4-aminobut-1-enyl)-2,6-dimethylaniline?
The InChIKey is JQGHFKGWKKYHMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-9-7-11(5-3-4-6-13)8-10(2)12(9)14/h3,5,7-8H,4,6,13-14H2,1-2H3.
What are the key properties of 4-(4-aminobut-1-enyl)-2,6-dimethylaniline?
4-(4-aminobut-1-enyl)-2,6-dimethylaniline has a molecular weight of 190.29 g/mol, XLogP of 2.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminobut-1-enyl)-2,6-dimethylaniline is sourced from PubChem (CID 170486974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).