C11H14N2O — CID 170481817
4-(3,4-diamino-5-methylphenyl)but-3-enal (PubChem CID 170481817) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-(3,4-diamino-5-methylphenyl)but-3-enal.
| Compound Name | 4-(3,4-diamino-5-methylphenyl)but-3-enal |
|---|---|
| PubChem CID | 170481817 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 4-(3,4-diamino-5-methylphenyl)but-3-enal |
| SMILES | Cc1cc(C=CCC=O)cc(N)c1N |
| InChI | InChI=1S/C11H14N2O/c1-8-6-9(4-2-3-5-14)7-10(12)11(8)13/h2,4-7H,3,12-13H2,1H3 |
| InChIKey | DTISLDLSRUOXQD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|