C11H13N3 — CID 170486897
5-(4-aminobut-1-enyl)-3-methylpyridine-2-carbonitrile (PubChem CID 170486897) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 5-(4-aminobut-1-enyl)-3-methylpyridine-2-carbonitrile.
| Compound Name | 5-(4-aminobut-1-enyl)-3-methylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 170486897 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 5-(4-aminobut-1-enyl)-3-methylpyridine-2-carbonitrile |
| SMILES | Cc1cc(C=CCCN)cnc1C#N |
| InChI | InChI=1S/C11H13N3/c1-9-6-10(4-2-3-5-12)8-14-11(9)7-13/h2,4,6,8H,3,5,12H2,1H3 |
| InChIKey | TXQBGELVCNZZMA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |